C29H27F5O3S — CID 58173333
(6aS,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[[4-(trifluoromethyl)phenyl]methyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 58173333) has the molecular formula C29H27F5O3S and a molecular weight of 550.59 g/mol. Its IUPAC name is (6aS,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[[4-(trifluoromethyl)phenyl]methyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aS,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[[4-(trifluoromethyl)phenyl]methyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 58173333 |
| Molecular Formula | C29H27F5O3S |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | (6aS,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[[4-(trifluoromethyl)phenyl]methyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | O=S(=O)(CC[C@@H]1CCC[C@@]2(Cc3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C29H27F5O3S/c30-24-12-13-25(31)27-26(24)28(17-19-8-10-21(11-9-19)29(32,33)34)15-4-5-20(23(28)18-37-27)14-16-38(35,36)22-6-2-1-3-7-22/h1-3,6-13,20,23H,4-5,14-18H2/t20-,23-,28-/m0/s1 |
| InChIKey | HAWBYVBLUBXFGI-GTFGCAHESA-N |
| XLogP | 7.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |