C21H17ClN8O2 — CID 58173455
7-(7-amino-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 58173455) has the molecular formula C21H17ClN8O2 and a molecular weight of 448.87 g/mol. Its IUPAC name is 7-(7-amino-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 7-(7-amino-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 58173455 |
| Molecular Formula | C21H17ClN8O2 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 7-(7-amino-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | Nc1c(Cl)c(N2CCN3C(=O)NC(=O)C3C2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C21H17ClN8O2/c22-16-17(23)30-18(13(9-25-30)12-7-11-3-1-2-4-14(11)24-8-12)26-19(16)28-5-6-29-15(10-28)20(31)27-21(29)32/h1-4,7-9,15H,5-6,10,23H2,(H,27,31,32) |
| InChIKey | FIRWUSCJUGIQIZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|