C22H37N5O9 — CID 58173677
2-[4,7,10-tris(carboxymethyl)-6-[3-(prop-2-enoylamino)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 58173677) has the molecular formula C22H37N5O9 and a molecular weight of 515.56 g/mol. Its IUPAC name is 2-[4,7,10-tris(carboxymethyl)-6-[3-(prop-2-enoylamino)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris(carboxymethyl)-6-[3-(prop-2-enoylamino)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 58173677 |
| Molecular Formula | C22H37N5O9 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-6-[3-(prop-2-enoylamino)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | C=CC(=O)NCCCC1CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN1CC(=O)O |
| InChI | InChI=1S/C22H37N5O9/c1-2-18(28)23-5-3-4-17-12-26(15-21(33)34)9-8-24(13-19(29)30)6-7-25(14-20(31)32)10-11-27(17)16-22(35)36/h2,17H,1,3-16H2,(H,23,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | HSLQZTATLJQMDN-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 191.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|