C24H41N5O8 — CID 58173678
2-[4,10-bis(carboxymethyl)-7-[6-(2-methylprop-2-enoylamino)hexanoyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 58173678) has the molecular formula C24H41N5O8 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[6-(2-methylprop-2-enoylamino)hexanoyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[6-(2-methylprop-2-enoylamino)hexanoyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 58173678 |
| Molecular Formula | C24H41N5O8 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[6-(2-methylprop-2-enoylamino)hexanoyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | C=C(C)C(=O)NCCCCCC(=O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C24H41N5O8/c1-19(2)24(37)25-7-5-3-4-6-20(30)29-14-12-27(17-22(33)34)10-8-26(16-21(31)32)9-11-28(13-15-29)18-23(35)36/h1,3-18H2,2H3,(H,25,37)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | ANDXFTASPCJGJB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 171.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|