C29H52N4O7 — CID 58173682
tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 58173682) has the molecular formula C29H52N4O7 and a molecular weight of 568.76 g/mol. Its IUPAC name is tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 58173682 |
| Molecular Formula | C29H52N4O7 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | C=CC(=O)N1CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C29H52N4O7/c1-11-23(34)33-18-16-31(21-25(36)39-28(5,6)7)14-12-30(20-24(35)38-27(2,3)4)13-15-32(17-19-33)22-26(37)40-29(8,9)10/h11H,1,12-22H2,2-10H3 |
| InChIKey | QVLUQBQEYLRNTA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 108.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|