C23H40N4O7 — CID 58173696
ethyl 2-[4,10-bis(2-ethoxy-2-oxoethyl)-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 58173696) has the molecular formula C23H40N4O7 and a molecular weight of 484.59 g/mol. Its IUPAC name is ethyl 2-[4,10-bis(2-ethoxy-2-oxoethyl)-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | ethyl 2-[4,10-bis(2-ethoxy-2-oxoethyl)-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 58173696 |
| Molecular Formula | C23H40N4O7 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | ethyl 2-[4,10-bis(2-ethoxy-2-oxoethyl)-7-prop-2-enoyl-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | C=CC(=O)N1CCN(CC(=O)OCC)CCN(CC(=O)OCC)CCN(CC(=O)OCC)CC1 |
| InChI | InChI=1S/C23H40N4O7/c1-5-20(28)27-15-13-25(18-22(30)33-7-3)11-9-24(17-21(29)32-6-2)10-12-26(14-16-27)19-23(31)34-8-4/h5H,1,6-19H2,2-4H3 |
| InChIKey | RHWGGCGCYCAPID-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 108.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|