C12H24O2S — CID 58173947
(2S,4S,5R)-6-ethyl-4,5-dimethyl-2-propan-2-ylsulfanyloxan-3-ol (PubChem CID 58173947) has the molecular formula C12H24O2S and a molecular weight of 232.39 g/mol. Its IUPAC name is (2S,4S,5R)-6-ethyl-4,5-dimethyl-2-propan-2-ylsulfanyloxan-3-ol.
| Compound Name | (2S,4S,5R)-6-ethyl-4,5-dimethyl-2-propan-2-ylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 58173947 |
| Molecular Formula | C12H24O2S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2S,4S,5R)-6-ethyl-4,5-dimethyl-2-propan-2-ylsulfanyloxan-3-ol |
| SMILES | CCC1O[C@@H](SC(C)C)C(O)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C12H24O2S/c1-6-10-8(4)9(5)11(13)12(14-10)15-7(2)3/h7-13H,6H2,1-5H3/t8-,9+,10?,11?,12+/m1/s1 |
| InChIKey | JZSYXYKHBHIFDW-SGCDDIOWSA-N |
| XLogP | 2.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |