About N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine
N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine (PubChem CID 58174056) has the molecular formula C19H13F3N6O
and a molecular weight of 398.35 g/mol. Its IUPAC name is N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine.
Molecular Properties
| Compound Name | N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine |
| PubChem CID | 58174056 |
| Molecular Formula | C19H13F3N6O |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine |
| SMILES | Fc1cc(F)c(Oc2ccc(CCNc3ncnc4nccnc34)cc2)nc1F |
| InChI | InChI=1S/C19H13F3N6O/c20-13-9-14(21)19(28-16(13)22)29-12-3-1-11(2-4-12)5-6-24-17-15-18(27-10-26-17)25-8-7-23-15/h1-4,7-10H,5-6H2,(H,24,25,26,27) |
| InChIKey | DKGUGSZWITVZOW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine?
The IUPAC name of N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine (CID 58174056) is N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine.
What is the SMILES notation for N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine?
The canonical SMILES for N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine is Fc1cc(F)c(Oc2ccc(CCNc3ncnc4nccnc34)cc2)nc1F.
What is the InChIKey of N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine?
The InChIKey is DKGUGSZWITVZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N6O/c20-13-9-14(21)19(28-16(13)22)29-12-3-1-11(2-4-12)5-6-24-17-15-18(27-10-26-17)25-8-7-23-15/h1-4,7-10H,5-6H2,(H,24,25,26,27).
What are the key properties of N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine?
N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine has a molecular weight of 398.35 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine is sourced from PubChem (CID 58174056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).