C19H20FNO3 — CID 58174319
methyl (4aR,7S,7aS,12bS)-9-fluoro-7-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate (PubChem CID 58174319) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is methyl (4aR,7S,7aS,12bS)-9-fluoro-7-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate.
| Compound Name | methyl (4aR,7S,7aS,12bS)-9-fluoro-7-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 58174319 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl (4aR,7S,7aS,12bS)-9-fluoro-7-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
| SMILES | COC(=O)N1CC[C@]23c4c5ccc(F)c4O[C@H]2[C@@H](C)C=C[C@H]3C1C5 |
| InChI | InChI=1S/C19H20FNO3/c1-10-3-5-12-14-9-11-4-6-13(20)16-15(11)19(12,17(10)24-16)7-8-21(14)18(22)23-2/h3-6,10,12,14,17H,7-9H2,1-2H3/t10-,12-,14?,17-,19-/m0/s1 |
| InChIKey | UFDIVIUEAHMDDR-JZGYTYOVSA-N |
| XLogP | 3.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|