About 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane
6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane (PubChem CID 58174419) has the molecular formula C8H18BNO2
and a molecular weight of 171.05 g/mol. Its IUPAC name is 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane.
Molecular Properties
| Compound Name | 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane |
| PubChem CID | 58174419 |
| Molecular Formula | C8H18BNO2 |
| Molecular Weight | 171.05 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane |
| SMILES | CC(C)B1OCCN(C)CCO1 |
| InChI | InChI=1S/C8H18BNO2/c1-8(2)9-11-6-4-10(3)5-7-12-9/h8H,4-7H2,1-3H3 |
| InChIKey | WWYLHCYSILURKP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.05 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane?
The IUPAC name of 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane (CID 58174419) is 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane.
What is the SMILES notation for 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane?
The canonical SMILES for 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane is CC(C)B1OCCN(C)CCO1.
What is the InChIKey of 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane?
The InChIKey is WWYLHCYSILURKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18BNO2/c1-8(2)9-11-6-4-10(3)5-7-12-9/h8H,4-7H2,1-3H3.
What are the key properties of 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane?
6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane has a molecular weight of 171.05 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propan-2-yl-1,3,6,2-dioxazaborocane is sourced from PubChem (CID 58174419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).