About disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate
disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate (PubChem CID 58174805) has the molecular formula C20H31Na2O6PS2
and a molecular weight of 508.55 g/mol. Its IUPAC name is disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate.
Molecular Properties
| Compound Name | disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate |
| PubChem CID | 58174805 |
| Molecular Formula | C20H31Na2O6PS2 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate |
| SMILES | O=S(=O)([O-])C1CC(P(C2CC3CCC2C3)C2CC3CCC2C3)CC(S(=O)(=O)[O-])C1.[Na+].[Na+] |
| InChI | InChI=1S/C20H33O6PS2.2Na/c21-28(22,23)17-9-16(10-18(11-17)29(24,25)26)27(19-7-12-1-3-14(19)5-12)20-8-13-2-4-15(20)6-13;;/h12-20H,1-11H2,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2 |
| InChIKey | GVPPGZZSHYWJTF-UHFFFAOYSA-L |
| XLogP | -2.77 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate?
The IUPAC name of disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate (CID 58174805) is disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate.
What is the SMILES notation for disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate?
The canonical SMILES for disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate is O=S(=O)([O-])C1CC(P(C2CC3CCC2C3)C2CC3CCC2C3)CC(S(=O)(=O)[O-])C1.[Na+].[Na+].
What is the InChIKey of disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate?
The InChIKey is GVPPGZZSHYWJTF-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H33O6PS2.2Na/c21-28(22,23)17-9-16(10-18(11-17)29(24,25)26)27(19-7-12-1-3-14(19)5-12)20-8-13-2-4-15(20)6-13;;/h12-20H,1-11H2,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2.
What are the key properties of disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate?
disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate has a molecular weight of 508.55 g/mol, XLogP of -2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;5-[bis(2-bicyclo[2.2.1]heptanyl)phosphanyl]cyclohexane-1,3-disulfonate is sourced from PubChem (CID 58174805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).