About (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene
(3Z)-2-methyl-5-methylidenehepta-1,3,6-triene (PubChem CID 58174936) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene.
Molecular Properties
| Compound Name | (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene |
| PubChem CID | 58174936 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene |
| SMILES | C=CC(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C9H12/c1-5-9(4)7-6-8(2)3/h5-7H,1-2,4H2,3H3/b7-6- |
| InChIKey | HCASPONBRUORAA-SREVYHEPSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene?
The IUPAC name of (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene (CID 58174936) is (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene.
What is the SMILES notation for (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene?
The canonical SMILES for (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene is C=CC(=C)/C=C\C(=C)C.
What is the InChIKey of (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene?
The InChIKey is HCASPONBRUORAA-SREVYHEPSA-N. The full InChI is InChI=1S/C9H12/c1-5-9(4)7-6-8(2)3/h5-7H,1-2,4H2,3H3/b7-6-.
What are the key properties of (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene?
(3Z)-2-methyl-5-methylidenehepta-1,3,6-triene has a molecular weight of 120.19 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-methyl-5-methylidenehepta-1,3,6-triene is sourced from PubChem (CID 58174936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).