About 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile
2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 58175149) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
| PubChem CID | 58175149 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CCN(CC)C1=CC(=C(C#N)C#N)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21N3/c1-5-18(6-2)14-7-12(13(10-16)11-17)8-15(3,4)9-14/h7H,5-6,8-9H2,1-4H3 |
| InChIKey | MNBJTEXIRYMCOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile?
The IUPAC name of 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile (CID 58175149) is 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile.
What is the SMILES notation for 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile?
The canonical SMILES for 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile is CCN(CC)C1=CC(=C(C#N)C#N)CC(C)(C)C1.
What is the InChIKey of 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile?
The InChIKey is MNBJTEXIRYMCOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-5-18(6-2)14-7-12(13(10-16)11-17)8-15(3,4)9-14/h7H,5-6,8-9H2,1-4H3.
What are the key properties of 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile?
2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile has a molecular weight of 243.35 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(diethylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile is sourced from PubChem (CID 58175149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).