C33H30F3IrN2O3- — CID 58175742
iridium;2-[4-(4-methylphenyl)phenyl]-5-[4-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-1,3,4-oxadiazole;pentane-2,4-diol (PubChem CID 58175742) has the molecular formula C33H30F3IrN2O3- and a molecular weight of 751.83 g/mol. Its IUPAC name is iridium;2-[4-(4-methylphenyl)phenyl]-5-[4-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-1,3,4-oxadiazole;pentane-2,4-diol.
| Compound Name | iridium;2-[4-(4-methylphenyl)phenyl]-5-[4-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-1,3,4-oxadiazole;pentane-2,4-diol |
|---|---|
| PubChem CID | 58175742 |
| Molecular Formula | C33H30F3IrN2O3- |
| Molecular Weight | 751.83 g/mol |
| Exact Mass | 752.18 |
| IUPAC Name | iridium;2-[4-(4-methylphenyl)phenyl]-5-[4-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-1,3,4-oxadiazole;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cc1ccc(-c2ccc(-c3nnc(-c4[c-]cc(-c5ccc(C(F)(F)F)cc5)cc4)o3)cc2)cc1.[Ir] |
| InChI | InChI=1S/C28H18F3N2O.C5H12O2.Ir/c1-18-2-4-19(5-3-18)20-6-10-23(11-7-20)26-32-33-27(34-26)24-12-8-21(9-13-24)22-14-16-25(17-15-22)28(29,30)31;1-4(6)3-5(2)7;/h2-12,14-17H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | LJIHZYQUPAPZDD-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.83 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|