C21H23F3NO3S- — CID 58176166
4-[4-[(1S)-2,2,2-trifluoro-1-[[(3S)-5-methyl-2-oxohexan-3-yl]amino]ethyl]phenyl]benzenesulfinate (PubChem CID 58176166) has the molecular formula C21H23F3NO3S- and a molecular weight of 426.48 g/mol. Its IUPAC name is 4-[4-[(1S)-2,2,2-trifluoro-1-[[(3S)-5-methyl-2-oxohexan-3-yl]amino]ethyl]phenyl]benzenesulfinate.
| Compound Name | 4-[4-[(1S)-2,2,2-trifluoro-1-[[(3S)-5-methyl-2-oxohexan-3-yl]amino]ethyl]phenyl]benzenesulfinate |
|---|---|
| PubChem CID | 58176166 |
| Molecular Formula | C21H23F3NO3S- |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-[4-[(1S)-2,2,2-trifluoro-1-[[(3S)-5-methyl-2-oxohexan-3-yl]amino]ethyl]phenyl]benzenesulfinate |
| SMILES | CC(=O)[C@H](CC(C)C)N[C@@H](c1ccc(-c2ccc(S(=O)[O-])cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H24F3NO3S/c1-13(2)12-19(14(3)26)25-20(21(22,23)24)17-6-4-15(5-7-17)16-8-10-18(11-9-16)29(27)28/h4-11,13,19-20,25H,12H2,1-3H3,(H,27,28)/p-1/t19-,20-/m0/s1 |
| InChIKey | ADDACPHVJKGSJW-PMACEKPBSA-M |
| XLogP | 4.79 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|