About N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten
N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten (PubChem CID 58176202) has the molecular formula C24H20NO3W-
and a molecular weight of 554.27 g/mol. Its IUPAC name is N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten.
Molecular Properties
| Compound Name | N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten |
| PubChem CID | 58176202 |
| Molecular Formula | C24H20NO3W- |
| Molecular Weight | 554.27 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten |
| SMILES | [CH2-]C(=O)C1(C(=O)CNC(=O)c2ccc3ccccc3c2)Cc2ccccc2C1.[W] |
| InChI | InChI=1S/C24H20NO3.W/c1-16(26)24(13-20-8-4-5-9-21(20)14-24)22(27)15-25-23(28)19-11-10-17-6-2-3-7-18(17)12-19;/h2-12H,1,13-15H2,(H,25,28);/q-1; |
| InChIKey | RNODGTDSEITXKL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 554.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten?
The IUPAC name of N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten (CID 58176202) is N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten.
What is the SMILES notation for N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten?
The canonical SMILES for N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten is [CH2-]C(=O)C1(C(=O)CNC(=O)c2ccc3ccccc3c2)Cc2ccccc2C1.[W].
What is the InChIKey of N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten?
The InChIKey is RNODGTDSEITXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20NO3.W/c1-16(26)24(13-20-8-4-5-9-21(20)14-24)22(27)15-25-23(28)19-11-10-17-6-2-3-7-18(17)12-19;/h2-12H,1,13-15H2,(H,25,28);/q-1;.
What are the key properties of N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten?
N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten has a molecular weight of 554.27 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-acetyl-1,3-dihydroinden-2-yl)-2-oxoethyl]naphthalene-2-carboxamide;tungsten is sourced from PubChem (CID 58176202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).