C33H39B3O8 — CID 58176411
[4-[2,4-bis[4-(4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran-2-yl)phenyl]pentan-3-yl]phenyl]boronic acid (PubChem CID 58176411) has the molecular formula C33H39B3O8 and a molecular weight of 596.10 g/mol. Its IUPAC name is [4-[2,4-bis[4-(4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran-2-yl)phenyl]pentan-3-yl]phenyl]boronic acid.
| Compound Name | [4-[2,4-bis[4-(4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran-2-yl)phenyl]pentan-3-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 58176411 |
| Molecular Formula | C33H39B3O8 |
| Molecular Weight | 596.10 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | [4-[2,4-bis[4-(4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran-2-yl)phenyl]pentan-3-yl]phenyl]boronic acid |
| SMILES | CC(c1ccc(B2OC3CCOCC3O2)cc1)C(c1ccc(B(O)O)cc1)C(C)c1ccc(B2OC3CCOCC3O2)cc1 |
| InChI | InChI=1S/C33H39B3O8/c1-21(23-3-11-27(12-4-23)35-41-29-15-17-39-19-31(29)43-35)33(25-7-9-26(10-8-25)34(37)38)22(2)24-5-13-28(14-6-24)36-42-30-16-18-40-20-32(30)44-36/h3-14,21-22,29-33,37-38H,15-20H2,1-2H3 |
| InChIKey | WBZNBMIOLFYCBY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.10 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|