C39H47FN4O6 — CID 58176645
[(1S,4R,6R,7Z,14S,18R)-4-[[3-(benzylamino)-3-oxopropyl]carbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 58176645) has the molecular formula C39H47FN4O6 and a molecular weight of 686.83 g/mol. Its IUPAC name is [(1S,4R,6R,7Z,14S,18R)-4-[[3-(benzylamino)-3-oxopropyl]carbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(1S,4R,6R,7Z,14S,18R)-4-[[3-(benzylamino)-3-oxopropyl]carbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 58176645 |
| Molecular Formula | C39H47FN4O6 |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | [(1S,4R,6R,7Z,14S,18R)-4-[[3-(benzylamino)-3-oxopropyl]carbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C[C@H]1CCCCC/C=C\[C@H]2C[C@@]2(C(=O)NCCC(=O)NCc2ccccc2)CC(=O)[C@@H]2C[C@@H](OC(=O)N3Cc4cccc(F)c4C3)CN2C1=O |
| InChI | InChI=1S/C39H47FN4O6/c1-26-11-6-3-2-4-9-15-29-20-39(29,37(48)41-18-17-35(46)42-22-27-12-7-5-8-13-27)21-34(45)33-19-30(24-44(33)36(26)47)50-38(49)43-23-28-14-10-16-32(40)31(28)25-43/h5,7-10,12-16,26,29-30,33H,2-4,6,11,17-25H2,1H3,(H,41,48)(H,42,46)/b15-9-/t26-,29-,30+,33-,39+/m0/s1 |
| InChIKey | IQOKZKMXFPLZFN-ROENZGLQSA-N |
| XLogP | 5.19 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|