C31H42N4O9S — CID 58176977
[(1S,4R,6R,7Z,14S,18R)-4-[[2-(2-amino-2-oxoethoxy)phenyl]sulfonylcarbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] N,N-dimethylcarbamate (PubChem CID 58176977) has the molecular formula C31H42N4O9S and a molecular weight of 646.76 g/mol. Its IUPAC name is [(1S,4R,6R,7Z,14S,18R)-4-[[2-(2-amino-2-oxoethoxy)phenyl]sulfonylcarbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] N,N-dimethylcarbamate.
| Compound Name | [(1S,4R,6R,7Z,14S,18R)-4-[[2-(2-amino-2-oxoethoxy)phenyl]sulfonylcarbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 58176977 |
| Molecular Formula | C31H42N4O9S |
| Molecular Weight | 646.76 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | [(1S,4R,6R,7Z,14S,18R)-4-[[2-(2-amino-2-oxoethoxy)phenyl]sulfonylcarbamoyl]-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] N,N-dimethylcarbamate |
| SMILES | C[C@H]1CCCCC/C=C\[C@H]2C[C@@]2(C(=O)NS(=O)(=O)c2ccccc2OCC(N)=O)CC(=O)[C@@H]2C[C@@H](OC(=O)N(C)C)CN2C1=O |
| InChI | InChI=1S/C31H42N4O9S/c1-20-11-7-5-4-6-8-12-21-16-31(21,17-24(36)23-15-22(18-35(23)28(20)38)44-30(40)34(2)3)29(39)33-45(41,42)26-14-10-9-13-25(26)43-19-27(32)37/h8-10,12-14,20-23H,4-7,11,15-19H2,1-3H3,(H2,32,37)(H,33,39)/b12-8-/t20-,21-,22+,23-,31+/m0/s1 |
| InChIKey | YNAUOHLRISWXGC-ZVTIDKNCSA-N |
| XLogP | 2.15 |
| TPSA | 182.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|