C39H41N3O5S — CID 58177039
(1S,4R,6R,7Z,14R,18R)-18-(1,3-benzothiazol-2-yloxy)-14-benzyl-2,15-dioxo-N-phenoxy-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 58177039) has the molecular formula C39H41N3O5S and a molecular weight of 663.84 g/mol. Its IUPAC name is (1S,4R,6R,7Z,14R,18R)-18-(1,3-benzothiazol-2-yloxy)-14-benzyl-2,15-dioxo-N-phenoxy-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | (1S,4R,6R,7Z,14R,18R)-18-(1,3-benzothiazol-2-yloxy)-14-benzyl-2,15-dioxo-N-phenoxy-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 58177039 |
| Molecular Formula | C39H41N3O5S |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | (1S,4R,6R,7Z,14R,18R)-18-(1,3-benzothiazol-2-yloxy)-14-benzyl-2,15-dioxo-N-phenoxy-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | O=C1C[C@]2(C(=O)NOc3ccccc3)C[C@@H]2/C=C\CCCCC[C@H](Cc2ccccc2)C(=O)N2C[C@H](Oc3nc4ccccc4s3)C[C@@H]12 |
| InChI | InChI=1S/C39H41N3O5S/c43-34-25-39(37(45)41-47-30-18-10-5-11-19-30)24-29(39)17-9-3-1-2-8-16-28(22-27-14-6-4-7-15-27)36(44)42-26-31(23-33(34)42)46-38-40-32-20-12-13-21-35(32)48-38/h4-7,9-15,17-21,28-29,31,33H,1-3,8,16,22-26H2,(H,41,45)/b17-9-/t28-,29+,31-,33+,39-/m1/s1 |
| InChIKey | VNUCZOGEKPPWOS-RTVUTPIPSA-N |
| XLogP | 7.10 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|