C25H38N6O3SSi — CID 58177341
N-(1-ethylsulfonylpiperidin-3-yl)-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine (PubChem CID 58177341) has the molecular formula C25H38N6O3SSi and a molecular weight of 530.77 g/mol. Its IUPAC name is N-(1-ethylsulfonylpiperidin-3-yl)-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine.
| Compound Name | N-(1-ethylsulfonylpiperidin-3-yl)-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58177341 |
| Molecular Formula | C25H38N6O3SSi |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N-(1-ethylsulfonylpiperidin-3-yl)-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
| SMILES | CCS(=O)(=O)N1CCCC(Nc2nc(C)ccc2-c2cnc3c(ccn3COCC[Si](C)(C)C)n2)C1 |
| InChI | InChI=1S/C25H38N6O3SSi/c1-6-35(32,33)31-12-7-8-20(17-31)28-24-21(10-9-19(2)27-24)23-16-26-25-22(29-23)11-13-30(25)18-34-14-15-36(3,4)5/h9-11,13,16,20H,6-8,12,14-15,17-18H2,1-5H3,(H,27,28) |
| InChIKey | ZJUDSPZACAJETO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|