C28H44N6O3SSi — CID 58177400
N-[1-(2,2-dimethylpropylsulfonyl)piperidin-3-yl]-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine (PubChem CID 58177400) has the molecular formula C28H44N6O3SSi and a molecular weight of 572.85 g/mol. Its IUPAC name is N-[1-(2,2-dimethylpropylsulfonyl)piperidin-3-yl]-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine.
| Compound Name | N-[1-(2,2-dimethylpropylsulfonyl)piperidin-3-yl]-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58177400 |
| Molecular Formula | C28H44N6O3SSi |
| Molecular Weight | 572.85 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | N-[1-(2,2-dimethylpropylsulfonyl)piperidin-3-yl]-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
| SMILES | Cc1ccc(-c2cnc3c(ccn3COCC[Si](C)(C)C)n2)c(NC2CCCN(S(=O)(=O)CC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C28H44N6O3SSi/c1-21-10-11-23(25-17-29-27-24(32-25)12-14-33(27)20-37-15-16-39(5,6)7)26(30-21)31-22-9-8-13-34(18-22)38(35,36)19-28(2,3)4/h10-12,14,17,22H,8-9,13,15-16,18-20H2,1-7H3,(H,30,31) |
| InChIKey | AEUXLOGEADKMTG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.85 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|