C25H37FN6OSi — CID 58177408
2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-dimethyl-(2,2,7,7-tetramethylazepan-4-yl)silane (PubChem CID 58177408) has the molecular formula C25H37FN6OSi and a molecular weight of 484.70 g/mol. Its IUPAC name is 2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-dimethyl-(2,2,7,7-tetramethylazepan-4-yl)silane.
| Compound Name | 2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-dimethyl-(2,2,7,7-tetramethylazepan-4-yl)silane |
|---|---|
| PubChem CID | 58177408 |
| Molecular Formula | C25H37FN6OSi |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-[[2-(3-fluoropyrazin-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-dimethyl-(2,2,7,7-tetramethylazepan-4-yl)silane |
| SMILES | CC1(C)CCC([Si](C)(C)CCOCn2ccc3nc(-c4nccnc4F)cnc32)CC(C)(C)N1 |
| InChI | InChI=1S/C25H37FN6OSi/c1-24(2)9-7-18(15-25(3,4)31-24)34(5,6)14-13-33-17-32-12-8-19-23(32)29-16-20(30-19)21-22(26)28-11-10-27-21/h8,10-12,16,18,31H,7,9,13-15,17H2,1-6H3 |
| InChIKey | LPYACPOTUQZFBO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|