C50H42N4O6 — CID 58177723
1'-[[4-[4-[(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 58177723) has the molecular formula C50H42N4O6 and a molecular weight of 794.91 g/mol. Its IUPAC name is 1'-[[4-[4-[(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 1'-[[4-[4-[(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 58177723 |
| Molecular Formula | C50H42N4O6 |
| Molecular Weight | 794.91 g/mol |
| Exact Mass | 794.31 |
| IUPAC Name | 1'-[[4-[4-[(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CC1(C)c2ccccc2N(Cc2ccc(-c3ccc(CN4c5ccccc5C(C)(C)C45C=Cc4cc([N+](=O)[O-])ccc4O5)cc3)cc2)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C50H42N4O6/c1-47(2)41-9-5-7-11-43(41)51(49(47)27-25-37-29-39(53(55)56)21-23-45(37)59-49)31-33-13-17-35(18-14-33)36-19-15-34(16-20-36)32-52-44-12-8-6-10-42(44)48(3,4)50(52)28-26-38-30-40(54(57)58)22-24-46(38)60-50/h5-30H,31-32H2,1-4H3 |
| InChIKey | FXYPCSWRWHAQJI-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.91 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|