C40H52 — CID 58177742
9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 58177742) has the molecular formula C40H52 and a molecular weight of 532.86 g/mol. Its IUPAC name is 9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 58177742 |
| Molecular Formula | C40H52 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.41 |
| IUPAC Name | 9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | C=CCCC(CC1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21)C1C2C=CC=CC2C2C=CC=CC21 |
| InChI | InChI=1S/C40H52/c1-8-9-14-26(38-33-17-12-10-15-29(33)30-16-11-13-18-34(30)38)23-35-36-24-27(39(2,3)4)19-21-31(36)32-22-20-28(25-37(32)35)40(5,6)7/h8,10-13,15-22,24-26,29-38H,1,9,14,23H2,2-7H3 |
| InChIKey | DHUIZRXTBYDTGB-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|