About 7-oxonon-8-enylazanium
7-oxonon-8-enylazanium (PubChem CID 58177745) has the molecular formula C9H18NO+
and a molecular weight of 156.25 g/mol. Its IUPAC name is 7-oxonon-8-enylazanium.
Molecular Properties
| Compound Name | 7-oxonon-8-enylazanium |
| PubChem CID | 58177745 |
| Molecular Formula | C9H18NO+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 7-oxonon-8-enylazanium |
| SMILES | C=CC(=O)CCCCCC[NH3+] |
| InChI | InChI=1S/C9H17NO/c1-2-9(11)7-5-3-4-6-8-10/h2H,1,3-8,10H2/p+1 |
| InChIKey | NUAZUQKABADYPU-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-oxonon-8-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxonon-8-enylazanium?
The IUPAC name of 7-oxonon-8-enylazanium (CID 58177745) is 7-oxonon-8-enylazanium.
What is the SMILES notation for 7-oxonon-8-enylazanium?
The canonical SMILES for 7-oxonon-8-enylazanium is C=CC(=O)CCCCCC[NH3+].
What is the InChIKey of 7-oxonon-8-enylazanium?
The InChIKey is NUAZUQKABADYPU-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H17NO/c1-2-9(11)7-5-3-4-6-8-10/h2H,1,3-8,10H2/p+1.
What are the key properties of 7-oxonon-8-enylazanium?
7-oxonon-8-enylazanium has a molecular weight of 156.25 g/mol, XLogP of 0.93, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxonon-8-enylazanium is sourced from PubChem (CID 58177745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).