About 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline
5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline (PubChem CID 58178009) has the molecular formula C18H16N2O4
and a molecular weight of 324.34 g/mol. Its IUPAC name is 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline.
Molecular Properties
| Compound Name | 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline |
| PubChem CID | 58178009 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline |
| SMILES | COc1ccc(-c2conc2-c2cc(C)c3c(c2)OCO3)c(N)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-10-5-11(6-16-18(10)23-9-22-16)17-14(8-24-20-17)13-4-3-12(21-2)7-15(13)19/h3-8H,9,19H2,1-2H3 |
| InChIKey | FIAIMUYPEMXIQP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline?
The IUPAC name of 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline (CID 58178009) is 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline.
What is the SMILES notation for 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline?
The canonical SMILES for 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline is COc1ccc(-c2conc2-c2cc(C)c3c(c2)OCO3)c(N)c1.
What is the InChIKey of 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline?
The InChIKey is FIAIMUYPEMXIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-10-5-11(6-16-18(10)23-9-22-16)17-14(8-24-20-17)13-4-3-12(21-2)7-15(13)19/h3-8H,9,19H2,1-2H3.
What are the key properties of 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline?
5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline has a molecular weight of 324.34 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]aniline is sourced from PubChem (CID 58178009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).