C18H16NO7PS — CID 58178067
[5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylphenyl] dihydrogen phosphate (PubChem CID 58178067) has the molecular formula C18H16NO7PS and a molecular weight of 421.37 g/mol. Its IUPAC name is [5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylphenyl] dihydrogen phosphate.
| Compound Name | [5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58178067 |
| Molecular Formula | C18H16NO7PS |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | [5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylphenyl] dihydrogen phosphate |
| SMILES | CSc1ccc(-c2conc2-c2cc(C)c3c(c2)OCO3)cc1OP(=O)(O)O |
| InChI | InChI=1S/C18H16NO7PS/c1-10-5-12(7-15-18(10)24-9-23-15)17-13(8-25-19-17)11-3-4-16(28-2)14(6-11)26-27(20,21)22/h3-8H,9H2,1-2H3,(H2,20,21,22) |
| InChIKey | FCLYWMDLTNVEPP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|