About 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole
5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole (PubChem CID 58178077) has the molecular formula C15H11N3O4
and a molecular weight of 297.27 g/mol. Its IUPAC name is 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole |
| PubChem CID | 58178077 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole |
| SMILES | COc1cc(-c2oncc2-c2cncnc2)cc2c1OCO2 |
| InChI | InChI=1S/C15H11N3O4/c1-19-12-2-9(3-13-15(12)21-8-20-13)14-11(6-18-22-14)10-4-16-7-17-5-10/h2-7H,8H2,1H3 |
| InChIKey | AYOTZNVOLKTQHE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole?
The IUPAC name of 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole (CID 58178077) is 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole.
What is the SMILES notation for 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole?
The canonical SMILES for 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole is COc1cc(-c2oncc2-c2cncnc2)cc2c1OCO2.
What is the InChIKey of 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole?
The InChIKey is AYOTZNVOLKTQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O4/c1-19-12-2-9(3-13-15(12)21-8-20-13)14-11(6-18-22-14)10-4-16-7-17-5-10/h2-7H,8H2,1H3.
What are the key properties of 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole?
5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole has a molecular weight of 297.27 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-methoxy-1,3-benzodioxol-5-yl)-4-pyrimidin-5-yl-1,2-oxazole is sourced from PubChem (CID 58178077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).