About 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate
4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate (PubChem CID 58178231) has the molecular formula C17H12NO4-
and a molecular weight of 294.29 g/mol. Its IUPAC name is 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate.
Molecular Properties
| Compound Name | 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate |
| PubChem CID | 58178231 |
| Molecular Formula | C17H12NO4- |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate |
| SMILES | Cc1cc(-c2nocc2-c2ccc([O-])cc2)cc2c1OCO2 |
| InChI | InChI=1S/C17H13NO4/c1-10-6-12(7-15-17(10)21-9-20-15)16-14(8-22-18-16)11-2-4-13(19)5-3-11/h2-8,19H,9H2,1H3/p-1 |
| InChIKey | DBGAOKGMUJLXMO-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate?
The IUPAC name of 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate (CID 58178231) is 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate.
What is the SMILES notation for 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate?
The canonical SMILES for 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate is Cc1cc(-c2nocc2-c2ccc([O-])cc2)cc2c1OCO2.
What is the InChIKey of 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate?
The InChIKey is DBGAOKGMUJLXMO-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H13NO4/c1-10-6-12(7-15-17(10)21-9-20-15)16-14(8-22-18-16)11-2-4-13(19)5-3-11/h2-8,19H,9H2,1H3/p-1.
What are the key properties of 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate?
4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate has a molecular weight of 294.29 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenolate is sourced from PubChem (CID 58178231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).