About 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline
5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline (PubChem CID 58178272) has the molecular formula C18H16N2O4S
and a molecular weight of 356.40 g/mol. Its IUPAC name is 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline.
Molecular Properties
| Compound Name | 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline |
| PubChem CID | 58178272 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline |
| SMILES | COc1cc(-c2oncc2-c2ccc(SC)c(N)c2)cc2c1OCO2 |
| InChI | InChI=1S/C18H16N2O4S/c1-21-14-6-11(7-15-18(14)23-9-22-15)17-12(8-20-24-17)10-3-4-16(25-2)13(19)5-10/h3-8H,9,19H2,1-2H3 |
| InChIKey | DLEVBIHPFVIAMF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline?
The IUPAC name of 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline (CID 58178272) is 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline.
What is the SMILES notation for 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline?
The canonical SMILES for 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline is COc1cc(-c2oncc2-c2ccc(SC)c(N)c2)cc2c1OCO2.
What is the InChIKey of 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline?
The InChIKey is DLEVBIHPFVIAMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4S/c1-21-14-6-11(7-15-18(14)23-9-22-15)17-12(8-20-24-17)10-3-4-16(25-2)13(19)5-10/h3-8H,9,19H2,1-2H3.
What are the key properties of 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline?
5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline has a molecular weight of 356.40 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline is sourced from PubChem (CID 58178272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).