About 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole
4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 58178281) has the molecular formula C19H19NO5
and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole |
| PubChem CID | 58178281 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1ccc(-c2conc2-c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-21-13-7-5-12(6-8-13)15-11-25-20-19(15)14-9-17(23-3)18(24-4)10-16(14)22-2/h5-11H,1-4H3 |
| InChIKey | FJGQVTRABREKFW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole?
The IUPAC name of 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole (CID 58178281) is 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole.
What is the SMILES notation for 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole?
The canonical SMILES for 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole is COc1ccc(-c2conc2-c2cc(OC)c(OC)cc2OC)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole?
The InChIKey is FJGQVTRABREKFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO5/c1-21-13-7-5-12(6-8-13)15-11-25-20-19(15)14-9-17(23-3)18(24-4)10-16(14)22-2/h5-11H,1-4H3.
What are the key properties of 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole?
4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole has a molecular weight of 341.36 g/mol, XLogP of 4.04, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)-1,2-oxazole is sourced from PubChem (CID 58178281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).