About 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole
5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole (PubChem CID 58178317) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole |
| PubChem CID | 58178317 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole |
| SMILES | COc1ccc(-c2cnoc2-c2cc(C)c(C)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-12-9-15(10-18(22-4)13(12)2)19-17(11-20-23-19)14-5-7-16(21-3)8-6-14/h5-11H,1-4H3 |
| InChIKey | SNGOCMNLFDVVJC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole?
The IUPAC name of 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole (CID 58178317) is 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole.
What is the SMILES notation for 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole?
The canonical SMILES for 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole is COc1ccc(-c2cnoc2-c2cc(C)c(C)c(OC)c2)cc1.
What is the InChIKey of 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole?
The InChIKey is SNGOCMNLFDVVJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c1-12-9-15(10-18(22-4)13(12)2)19-17(11-20-23-19)14-5-7-16(21-3)8-6-14/h5-11H,1-4H3.
What are the key properties of 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole?
5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole has a molecular weight of 309.37 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxy-4,5-dimethylphenyl)-4-(4-methoxyphenyl)-1,2-oxazole is sourced from PubChem (CID 58178317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).