C14H14O5 — CID 58178438
2-(2,5-dihydroxyphenyl)-2,6-dimethyl-5,6-dihydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 58178438) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-(2,5-dihydroxyphenyl)-2,6-dimethyl-5,6-dihydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | 2-(2,5-dihydroxyphenyl)-2,6-dimethyl-5,6-dihydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 58178438 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(2,5-dihydroxyphenyl)-2,6-dimethyl-5,6-dihydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1CC(=O)C2=C1OC(C)(c1cc(O)ccc1O)O2 |
| InChI | InChI=1S/C14H14O5/c1-7-5-11(17)13-12(7)18-14(2,19-13)9-6-8(15)3-4-10(9)16/h3-4,6-7,15-16H,5H2,1-2H3 |
| InChIKey | WODAVYZYESZXFM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|