About 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane
5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane (PubChem CID 58178478) has the molecular formula C22H27FO2S
and a molecular weight of 374.52 g/mol. Its IUPAC name is 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane.
Molecular Properties
| Compound Name | 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane |
| PubChem CID | 58178478 |
| Molecular Formula | C22H27FO2S |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane |
| SMILES | Cc1ccc(SC2OC(COCc3ccccc3)C(F)C(C)C2C)cc1 |
| InChI | InChI=1S/C22H27FO2S/c1-15-9-11-19(12-10-15)26-22-17(3)16(2)21(23)20(25-22)14-24-13-18-7-5-4-6-8-18/h4-12,16-17,20-22H,13-14H2,1-3H3 |
| InChIKey | VAKRYNCQNITFIX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane?
The IUPAC name of 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane (CID 58178478) is 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane.
What is the SMILES notation for 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane?
The canonical SMILES for 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane is Cc1ccc(SC2OC(COCc3ccccc3)C(F)C(C)C2C)cc1.
What is the InChIKey of 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane?
The InChIKey is VAKRYNCQNITFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27FO2S/c1-15-9-11-19(12-10-15)26-22-17(3)16(2)21(23)20(25-22)14-24-13-18-7-5-4-6-8-18/h4-12,16-17,20-22H,13-14H2,1-3H3.
What are the key properties of 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane?
5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane has a molecular weight of 374.52 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,4-dimethyl-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)oxane is sourced from PubChem (CID 58178478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).