About [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone
[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 58180159) has the molecular formula C17H15F2N7O
and a molecular weight of 371.35 g/mol. Its IUPAC name is [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 58180159 |
| Molecular Formula | C17H15F2N7O |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | Nc1ncc(C(=O)N2CCCC2)cc1-c1nnnn1-c1cccc(F)c1F |
| InChI | InChI=1S/C17H15F2N7O/c18-12-4-3-5-13(14(12)19)26-16(22-23-24-26)11-8-10(9-21-15(11)20)17(27)25-6-1-2-7-25/h3-5,8-9H,1-2,6-7H2,(H2,20,21) |
| InChIKey | HMKPNESSMWCFCZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone (CID 58180159) is [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone is Nc1ncc(C(=O)N2CCCC2)cc1-c1nnnn1-c1cccc(F)c1F.
What is the InChIKey of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone?
The InChIKey is HMKPNESSMWCFCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N7O/c18-12-4-3-5-13(14(12)19)26-16(22-23-24-26)11-8-10(9-21-15(11)20)17(27)25-6-1-2-7-25/h3-5,8-9H,1-2,6-7H2,(H2,20,21).
What are the key properties of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone?
[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone has a molecular weight of 371.35 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 58180159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).