C22H30O3 — CID 58180357
4-[2-[(1R,2R)-2-hexyl-3-hydroxy-5-oxocyclopentyl]ethyl]-2,3-dihydroinden-1-one (PubChem CID 58180357) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-2-hexyl-3-hydroxy-5-oxocyclopentyl]ethyl]-2,3-dihydroinden-1-one.
| Compound Name | 4-[2-[(1R,2R)-2-hexyl-3-hydroxy-5-oxocyclopentyl]ethyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 58180357 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-[2-[(1R,2R)-2-hexyl-3-hydroxy-5-oxocyclopentyl]ethyl]-2,3-dihydroinden-1-one |
| SMILES | CCCCCC[C@H]1C(O)CC(=O)[C@@H]1CCc1cccc2c1CCC2=O |
| InChI | InChI=1S/C22H30O3/c1-2-3-4-5-8-18-19(22(25)14-21(18)24)11-10-15-7-6-9-17-16(15)12-13-20(17)23/h6-7,9,18-19,21,24H,2-5,8,10-14H2,1H3/t18-,19-,21?/m1/s1 |
| InChIKey | BRYGOBQTFKKPFK-AQFHOAJTSA-N |
| XLogP | 4.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|