C32H38FN9O3Si — CID 58180945
4-[4-(2-fluoro-4-isocyanobenzoyl)-2-(hydroxymethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile (PubChem CID 58180945) has the molecular formula C32H38FN9O3Si and a molecular weight of 643.80 g/mol. Its IUPAC name is 4-[4-(2-fluoro-4-isocyanobenzoyl)-2-(hydroxymethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile.
| Compound Name | 4-[4-(2-fluoro-4-isocyanobenzoyl)-2-(hydroxymethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 58180945 |
| Molecular Formula | C32H38FN9O3Si |
| Molecular Weight | 643.80 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | 4-[4-(2-fluoro-4-isocyanobenzoyl)-2-(hydroxymethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
| SMILES | [C-]#[N+]c1ccc(C(=O)N2CCN(CC(CC#N)n3cc(-c4ncnc5c4ccn5COCC[Si](C)(C)C)cn3)C(CO)C2)c(F)c1 |
| InChI | InChI=1S/C32H38FN9O3Si/c1-35-24-5-6-27(29(33)15-24)32(44)40-12-11-39(26(19-40)20-43)18-25(7-9-34)42-17-23(16-38-42)30-28-8-10-41(31(28)37-21-36-30)22-45-13-14-46(2,3)4/h5-6,8,10,15-17,21,25-26,43H,7,11-14,18-20,22H2,2-4H3 |
| InChIKey | YGBKNNYRHMJSAQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|