C36H36ClN3O2 — CID 58181040
(3S,5R)-5-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]-1-(2,2-diphenylethyl)-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one (PubChem CID 58181040) has the molecular formula C36H36ClN3O2 and a molecular weight of 578.16 g/mol. Its IUPAC name is (3S,5R)-5-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]-1-(2,2-diphenylethyl)-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one.
| Compound Name | (3S,5R)-5-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]-1-(2,2-diphenylethyl)-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 58181040 |
| Molecular Formula | C36H36ClN3O2 |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | (3S,5R)-5-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]-1-(2,2-diphenylethyl)-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)CC[C@@H]1CCN(CC(c2ccccc2)c2ccccc2)C(=O)[C@H](Cc2ccccn2)N1 |
| InChI | InChI=1S/C36H36ClN3O2/c37-30-17-14-27(15-18-30)16-20-33(41)21-19-31-22-24-40(36(42)35(39-31)25-32-13-7-8-23-38-32)26-34(28-9-3-1-4-10-28)29-11-5-2-6-12-29/h1-18,20,23,31,34-35,39H,19,21-22,24-26H2/b20-16+/t31-,35+/m1/s1 |
| InChIKey | NOYNQJNFEDMAEL-HCPMBAJMSA-N |
| XLogP | 6.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|