C22H24N2O3 — CID 58181285
tert-butyl N-[[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]acetyl]amino]carbamate (PubChem CID 58181285) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]acetyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 58181285 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | tert-butyl N-[[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]acetyl]amino]carbamate |
| SMILES | Cc1ccc(C#Cc2ccc(CC(=O)NNC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-16-5-7-17(8-6-16)9-10-18-11-13-19(14-12-18)15-20(25)23-24-21(26)27-22(2,3)4/h5-8,11-14H,15H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | VPAHLYICJNBKIQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|