C20H25BrCl2NO3Y- — CID 58182397
[4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate;yttrium (PubChem CID 58182397) has the molecular formula C20H25BrCl2NO3Y- and a molecular weight of 567.14 g/mol. Its IUPAC name is [4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate;yttrium.
| Compound Name | [4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate;yttrium |
|---|---|
| PubChem CID | 58182397 |
| Molecular Formula | C20H25BrCl2NO3Y- |
| Molecular Weight | 567.14 g/mol |
| Exact Mass | 564.95 |
| IUPAC Name | [4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate;yttrium |
| SMILES | [CH2-]CC/C=C\C[C@H]1CC(Br)C(Cl)[C@@H]1COc1cc(Cl)nc(COC(C)=O)c1.[Y] |
| InChI | InChI=1S/C20H25BrCl2NO3.Y/c1-3-4-5-6-7-14-8-18(21)20(23)17(14)12-27-16-9-15(11-26-13(2)25)24-19(22)10-16;/h5-6,9-10,14,17-18,20H,1,3-4,7-8,11-12H2,2H3;/q-1;/b6-5-;/t14-,17+,18?,20?;/m0./s1 |
| InChIKey | MJICLKIBABARNN-AXGURRMASA-N |
| XLogP | 5.74 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.14 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|