C23H22Cl3F2NO4 — CID 58182761
1-[4-[5-[chloro(difluoro)methyl]-5-(3,5-dichlorophenyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-4,4-dimethoxybutan-1-one (PubChem CID 58182761) has the molecular formula C23H22Cl3F2NO4 and a molecular weight of 520.79 g/mol. Its IUPAC name is 1-[4-[5-[chloro(difluoro)methyl]-5-(3,5-dichlorophenyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-4,4-dimethoxybutan-1-one.
| Compound Name | 1-[4-[5-[chloro(difluoro)methyl]-5-(3,5-dichlorophenyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-4,4-dimethoxybutan-1-one |
|---|---|
| PubChem CID | 58182761 |
| Molecular Formula | C23H22Cl3F2NO4 |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 1-[4-[5-[chloro(difluoro)methyl]-5-(3,5-dichlorophenyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-4,4-dimethoxybutan-1-one |
| SMILES | COC(CCC(=O)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)Cl)C2)cc1C)OC |
| InChI | InChI=1S/C23H22Cl3F2NO4/c1-13-8-14(4-5-18(13)20(30)6-7-21(31-2)32-3)19-12-22(33-29-19,23(26,27)28)15-9-16(24)11-17(25)10-15/h4-5,8-11,21H,6-7,12H2,1-3H3 |
| InChIKey | YJLLVISBJQDTDR-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|