About [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide
[methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 58183120) has the molecular formula C8H11N3OS2
and a molecular weight of 229.33 g/mol. Its IUPAC name is [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide.
Molecular Properties
| Compound Name | [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide |
| PubChem CID | 58183120 |
| Molecular Formula | C8H11N3OS2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | Cc1ncc(C(C)S(C)(=O)=NC#N)s1 |
| InChI | InChI=1S/C8H11N3OS2/c1-6(14(3,12)11-5-9)8-4-10-7(2)13-8/h4,6H,1-3H3 |
| InChIKey | ROQYPCKJQHOZTQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide?
The IUPAC name of [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide (CID 58183120) is [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide.
What is the SMILES notation for [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide?
The canonical SMILES for [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide is Cc1ncc(C(C)S(C)(=O)=NC#N)s1.
What is the InChIKey of [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide?
The InChIKey is ROQYPCKJQHOZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS2/c1-6(14(3,12)11-5-9)8-4-10-7(2)13-8/h4,6H,1-3H3.
What are the key properties of [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide?
[methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide has a molecular weight of 229.33 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]-oxo-λ6-sulfanylidene]cyanamide is sourced from PubChem (CID 58183120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).