C9H14OS — CID 58183461
3,4,6,7,8,9-hexahydro-2H-1,5-benzoxathiepine (PubChem CID 58183461) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is 3,4,6,7,8,9-hexahydro-2H-1,5-benzoxathiepine.
| Compound Name | 3,4,6,7,8,9-hexahydro-2H-1,5-benzoxathiepine |
|---|---|
| PubChem CID | 58183461 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 3,4,6,7,8,9-hexahydro-2H-1,5-benzoxathiepine |
| SMILES | C1COC2=C(CCCC2)SC1 |
| InChI | InChI=1S/C9H14OS/c1-2-5-9-8(4-1)10-6-3-7-11-9/h1-7H2 |
| InChIKey | BWCBRPFNMDKACM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |