About (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate
(2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate (PubChem CID 58183504) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate.
Molecular Properties
| Compound Name | (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate |
| PubChem CID | 58183504 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(C)OCCCCOC1C |
| InChI | InChI=1S/C11H18O4/c1-4-10(12)15-11(3)9(2)13-7-5-6-8-14-11/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | WZNBHLYQYYECPV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate?
The IUPAC name of (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate (CID 58183504) is (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate.
What is the SMILES notation for (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate?
The canonical SMILES for (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate is C=CC(=O)OC1(C)OCCCCOC1C.
What is the InChIKey of (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate?
The InChIKey is WZNBHLYQYYECPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-4-10(12)15-11(3)9(2)13-7-5-6-8-14-11/h4,9H,1,5-8H2,2-3H3.
What are the key properties of (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate?
(2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate has a molecular weight of 214.26 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyl-1,4-dioxocan-2-yl) prop-2-enoate is sourced from PubChem (CID 58183504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).