About 3,6-dimethyl-2,3-dihydro-1,4-oxathiine
3,6-dimethyl-2,3-dihydro-1,4-oxathiine (PubChem CID 58183536) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is 3,6-dimethyl-2,3-dihydro-1,4-oxathiine.
Molecular Properties
| Compound Name | 3,6-dimethyl-2,3-dihydro-1,4-oxathiine |
| PubChem CID | 58183536 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 3,6-dimethyl-2,3-dihydro-1,4-oxathiine |
| SMILES | CC1=CSC(C)CO1 |
| InChI | InChI=1S/C6H10OS/c1-5-4-8-6(2)3-7-5/h4,6H,3H2,1-2H3 |
| InChIKey | ZBRVQAPXGXJYSS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-2,3-dihydro-1,4-oxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2,3-dihydro-1,4-oxathiine?
The IUPAC name of 3,6-dimethyl-2,3-dihydro-1,4-oxathiine (CID 58183536) is 3,6-dimethyl-2,3-dihydro-1,4-oxathiine.
What is the SMILES notation for 3,6-dimethyl-2,3-dihydro-1,4-oxathiine?
The canonical SMILES for 3,6-dimethyl-2,3-dihydro-1,4-oxathiine is CC1=CSC(C)CO1.
What is the InChIKey of 3,6-dimethyl-2,3-dihydro-1,4-oxathiine?
The InChIKey is ZBRVQAPXGXJYSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-5-4-8-6(2)3-7-5/h4,6H,3H2,1-2H3.
What are the key properties of 3,6-dimethyl-2,3-dihydro-1,4-oxathiine?
3,6-dimethyl-2,3-dihydro-1,4-oxathiine has a molecular weight of 130.21 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2,3-dihydro-1,4-oxathiine is sourced from PubChem (CID 58183536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).