About 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine
6,6-dimethyl-5,7-dihydro-1,4-oxathiepine (PubChem CID 58183544) has the molecular formula C7H12OS
and a molecular weight of 144.24 g/mol. Its IUPAC name is 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine.
Molecular Properties
| Compound Name | 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine |
| PubChem CID | 58183544 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine |
| SMILES | CC1(C)COC=CSC1 |
| InChI | InChI=1S/C7H12OS/c1-7(2)5-8-3-4-9-6-7/h3-4H,5-6H2,1-2H3 |
| InChIKey | NRDTVMHAQVBNCE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine?
The IUPAC name of 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine (CID 58183544) is 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine.
What is the SMILES notation for 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine?
The canonical SMILES for 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine is CC1(C)COC=CSC1.
What is the InChIKey of 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine?
The InChIKey is NRDTVMHAQVBNCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS/c1-7(2)5-8-3-4-9-6-7/h3-4H,5-6H2,1-2H3.
What are the key properties of 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine?
6,6-dimethyl-5,7-dihydro-1,4-oxathiepine has a molecular weight of 144.24 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-5,7-dihydro-1,4-oxathiepine is sourced from PubChem (CID 58183544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).