C10H16OS — CID 58183556
2,3,4,5,7,8,9,10-octahydro-1,6-benzoxathiocine (PubChem CID 58183556) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is 2,3,4,5,7,8,9,10-octahydro-1,6-benzoxathiocine.
| Compound Name | 2,3,4,5,7,8,9,10-octahydro-1,6-benzoxathiocine |
|---|---|
| PubChem CID | 58183556 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2,3,4,5,7,8,9,10-octahydro-1,6-benzoxathiocine |
| SMILES | C1CCSC2=C(CCCC2)OC1 |
| InChI | InChI=1S/C10H16OS/c1-2-6-10-9(5-1)11-7-3-4-8-12-10/h1-8H2 |
| InChIKey | YQGPRQAQTGDHIE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |