About CID 58183566
CID 58183566 (PubChem CID 58183566) has the molecular formula C9H16BO2
and a molecular weight of 167.04 g/mol.
Molecular Properties
| Compound Name | CID 58183566 |
| PubChem CID | 58183566 |
| Molecular Formula | C9H16BO2 |
| Molecular Weight | 167.04 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | — |
| SMILES | CC1[B]C2CCCC2(O)OCC1 |
| InChI | InChI=1S/C9H16BO2/c1-7-4-6-12-9(11)5-2-3-8(9)10-7/h7-8,11H,2-6H2,1H3 |
| InChIKey | FDKZGOVIARMQRK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.04 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58183566 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58183566?
The IUPAC name of CID 58183566 (CID 58183566) is not available.
What is the SMILES notation for CID 58183566?
The canonical SMILES for CID 58183566 is CC1[B]C2CCCC2(O)OCC1.
What is the InChIKey of CID 58183566?
The InChIKey is FDKZGOVIARMQRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BO2/c1-7-4-6-12-9(11)5-2-3-8(9)10-7/h7-8,11H,2-6H2,1H3.
What are the key properties of CID 58183566?
CID 58183566 has a molecular weight of 167.04 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58183566 is sourced from PubChem (CID 58183566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).