About 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine
2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine (PubChem CID 58183651) has the molecular formula C7H12OS
and a molecular weight of 144.24 g/mol. Its IUPAC name is 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine.
Molecular Properties
| Compound Name | 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine |
| PubChem CID | 58183651 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine |
| SMILES | CC1=C(C)SCCCO1 |
| InChI | InChI=1S/C7H12OS/c1-6-7(2)9-5-3-4-8-6/h3-5H2,1-2H3 |
| InChIKey | VUTSLGCERYIZLY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine?
The IUPAC name of 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine (CID 58183651) is 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine.
What is the SMILES notation for 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine?
The canonical SMILES for 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine is CC1=C(C)SCCCO1.
What is the InChIKey of 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine?
The InChIKey is VUTSLGCERYIZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS/c1-6-7(2)9-5-3-4-8-6/h3-5H2,1-2H3.
What are the key properties of 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine?
2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine has a molecular weight of 144.24 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-6,7-dihydro-5H-1,4-oxathiepine is sourced from PubChem (CID 58183651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).